C13H13F3N2 — CID 175005463
4-[3-(trifluoromethyl)phenyl]cyclohexa-2,4-diene-1,1-diamine (PubChem CID 175005463) has the molecular formula C13H13F3N2 and a molecular weight of 254.26 g/mol. Its IUPAC name is 4-[3-(trifluoromethyl)phenyl]cyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 4-[3-(trifluoromethyl)phenyl]cyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 175005463 |
| Molecular Formula | C13H13F3N2 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 4-[3-(trifluoromethyl)phenyl]cyclohexa-2,4-diene-1,1-diamine |
| SMILES | NC1(N)C=CC(c2cccc(C(F)(F)F)c2)=CC1 |
| InChI | InChI=1S/C13H13F3N2/c14-13(15,16)11-3-1-2-10(8-11)9-4-6-12(17,18)7-5-9/h1-6,8H,7,17-18H2 |
| InChIKey | SMJXHVWNLGAQQQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|