C14H12F6N2 — CID 87814236
6-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]cyclohexa-2,4-diene-1,1-diamine (PubChem CID 87814236) has the molecular formula C14H12F6N2 and a molecular weight of 322.25 g/mol. Its IUPAC name is 6-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]cyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 6-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]cyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 87814236 |
| Molecular Formula | C14H12F6N2 |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 6-(trifluoromethyl)-4-[3-(trifluoromethyl)phenyl]cyclohexa-2,4-diene-1,1-diamine |
| SMILES | NC1(N)C=CC(c2cccc(C(F)(F)F)c2)=CC1C(F)(F)F |
| InChI | InChI=1S/C14H12F6N2/c15-13(16,17)10-3-1-2-8(6-10)9-4-5-12(21,22)11(7-9)14(18,19)20/h1-7,11H,21-22H2 |
| InChIKey | GDJMOQVSTNONDW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|