C20H15N3O2 — CID 175005672
[6-(4-cyanophenyl)-5-methyl-2-phenyl-3-pyridinyl] carbamate (PubChem CID 175005672) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is [6-(4-cyanophenyl)-5-methyl-2-phenyl-3-pyridinyl] carbamate.
| Compound Name | [6-(4-cyanophenyl)-5-methyl-2-phenyl-3-pyridinyl] carbamate |
|---|---|
| PubChem CID | 175005672 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | [6-(4-cyanophenyl)-5-methyl-2-phenyl-3-pyridinyl] carbamate |
| SMILES | Cc1cc(OC(N)=O)c(-c2ccccc2)nc1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H15N3O2/c1-13-11-17(25-20(22)24)19(15-5-3-2-4-6-15)23-18(13)16-9-7-14(12-21)8-10-16/h2-11H,1H3,(H2,22,24) |
| InChIKey | OBVPBKVFWVNATM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |