About (4-cyanophenyl) 6-methylpyridine-2-carboxylate
(4-cyanophenyl) 6-methylpyridine-2-carboxylate (PubChem CID 31704187) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is (4-cyanophenyl) 6-methylpyridine-2-carboxylate.
Molecular Properties
| Compound Name | (4-cyanophenyl) 6-methylpyridine-2-carboxylate |
| PubChem CID | 31704187 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (4-cyanophenyl) 6-methylpyridine-2-carboxylate |
| SMILES | Cc1cccc(C(=O)Oc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C14H10N2O2/c1-10-3-2-4-13(16-10)14(17)18-12-7-5-11(9-15)6-8-12/h2-8H,1H3 |
| InChIKey | YEKPXSIGPRSSOE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-cyanophenyl) 6-methylpyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl) 6-methylpyridine-2-carboxylate?
The IUPAC name of (4-cyanophenyl) 6-methylpyridine-2-carboxylate (CID 31704187) is (4-cyanophenyl) 6-methylpyridine-2-carboxylate.
What is the SMILES notation for (4-cyanophenyl) 6-methylpyridine-2-carboxylate?
The canonical SMILES for (4-cyanophenyl) 6-methylpyridine-2-carboxylate is Cc1cccc(C(=O)Oc2ccc(C#N)cc2)n1.
What is the InChIKey of (4-cyanophenyl) 6-methylpyridine-2-carboxylate?
The InChIKey is YEKPXSIGPRSSOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c1-10-3-2-4-13(16-10)14(17)18-12-7-5-11(9-15)6-8-12/h2-8H,1H3.
What are the key properties of (4-cyanophenyl) 6-methylpyridine-2-carboxylate?
(4-cyanophenyl) 6-methylpyridine-2-carboxylate has a molecular weight of 238.25 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl) 6-methylpyridine-2-carboxylate is sourced from PubChem (CID 31704187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).