About benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate
benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate (PubChem CID 174632385) has the molecular formula C16H17FN4O2
and a molecular weight of 316.34 g/mol. Its IUPAC name is benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate.
Molecular Properties
| Compound Name | benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate |
| PubChem CID | 174632385 |
| Molecular Formula | C16H17FN4O2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate |
| SMILES | CCNNc1cccc(OC(N)=O)c1F.N#Cc1ccccc1 |
| InChI | InChI=1S/C9H12FN3O2.C7H5N/c1-2-12-13-6-4-3-5-7(8(6)10)15-9(11)14;8-6-7-4-2-1-3-5-7/h3-5,12-13H,2H2,1H3,(H2,11,14);1-5H |
| InChIKey | GUCVTTDUFLPLTI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate?
The IUPAC name of benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate (CID 174632385) is benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate.
What is the SMILES notation for benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate?
The canonical SMILES for benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate is CCNNc1cccc(OC(N)=O)c1F.N#Cc1ccccc1.
What is the InChIKey of benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate?
The InChIKey is GUCVTTDUFLPLTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN3O2.C7H5N/c1-2-12-13-6-4-3-5-7(8(6)10)15-9(11)14;8-6-7-4-2-1-3-5-7/h3-5,12-13H,2H2,1H3,(H2,11,14);1-5H.
What are the key properties of benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate?
benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate has a molecular weight of 316.34 g/mol, XLogP of 2.78, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzonitrile;[3-(2-ethylhydrazinyl)-2-fluorophenyl] carbamate is sourced from PubChem (CID 174632385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).