C27H37N3O4 — CID 175007350
methyl 2-[[2-amino-4-methyl-2-(5-phenylpentanoylamino)pentanoyl]amino]-3-phenylpropanoate (PubChem CID 175007350) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is methyl 2-[[2-amino-4-methyl-2-(5-phenylpentanoylamino)pentanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[2-amino-4-methyl-2-(5-phenylpentanoylamino)pentanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 175007350 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | methyl 2-[[2-amino-4-methyl-2-(5-phenylpentanoylamino)pentanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)C(N)(CC(C)C)NC(=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C27H37N3O4/c1-20(2)19-27(28,30-24(31)17-11-10-14-21-12-6-4-7-13-21)26(33)29-23(25(32)34-3)18-22-15-8-5-9-16-22/h4-9,12-13,15-16,20,23H,10-11,14,17-19,28H2,1-3H3,(H,29,33)(H,30,31) |
| InChIKey | NLRRXDSQUPKILY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|