C12H26O4Si2 — CID 175008849
ethyl 3-(2-methyl-1,1-disilyloxypropan-2-yl)cyclopentane-1-carboxylate (PubChem CID 175008849) has the molecular formula C12H26O4Si2 and a molecular weight of 290.51 g/mol. Its IUPAC name is ethyl 3-(2-methyl-1,1-disilyloxypropan-2-yl)cyclopentane-1-carboxylate.
| Compound Name | ethyl 3-(2-methyl-1,1-disilyloxypropan-2-yl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 175008849 |
| Molecular Formula | C12H26O4Si2 |
| Molecular Weight | 290.51 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | ethyl 3-(2-methyl-1,1-disilyloxypropan-2-yl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(C(C)(C)C(O[SiH3])O[SiH3])C1 |
| InChI | InChI=1S/C12H26O4Si2/c1-4-14-10(13)8-5-6-9(7-8)12(2,3)11(15-17)16-18/h8-9,11H,4-7H2,1-3,17-18H3 |
| InChIKey | OKKSTCXERVFGKT-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.51 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|