C32H62O — CID 175009732
7-(5,5-diethyldodec-8-en-6-yloxy)-8,8-diethyldodec-4-ene (PubChem CID 175009732) has the molecular formula C32H62O and a molecular weight of 462.85 g/mol. Its IUPAC name is 7-(5,5-diethyldodec-8-en-6-yloxy)-8,8-diethyldodec-4-ene.
| Compound Name | 7-(5,5-diethyldodec-8-en-6-yloxy)-8,8-diethyldodec-4-ene |
|---|---|
| PubChem CID | 175009732 |
| Molecular Formula | C32H62O |
| Molecular Weight | 462.85 g/mol |
| Exact Mass | 462.48 |
| IUPAC Name | 7-(5,5-diethyldodec-8-en-6-yloxy)-8,8-diethyldodec-4-ene |
| SMILES | CCCC=CCC(OC(CC=CCCC)C(CC)(CC)CCCC)C(CC)(CC)CCCC |
| InChI | InChI=1S/C32H62O/c1-9-17-21-23-25-29(31(13-5,14-6)27-19-11-3)33-30(26-24-22-18-10-2)32(15-7,16-8)28-20-12-4/h21-24,29-30H,9-20,25-28H2,1-8H3 |
| InChIKey | CIERRNKTJDZBLY-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.85 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|