About [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane
[(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane (PubChem CID 152749210) has the molecular formula C14H29IOSi
and a molecular weight of 368.38 g/mol. Its IUPAC name is [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane |
| PubChem CID | 152749210 |
| Molecular Formula | C14H29IOSi |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane |
| SMILES | CCCCC(C)(C)C(C/C=C/I)O[Si](C)(C)C |
| InChI | InChI=1S/C14H29IOSi/c1-7-8-11-14(2,3)13(10-9-12-15)16-17(4,5)6/h9,12-13H,7-8,10-11H2,1-6H3/b12-9+ |
| InChIKey | XRXZWYJHWFSWGO-FMIVXFBMSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane?
The IUPAC name of [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane (CID 152749210) is [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane.
What is the SMILES notation for [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane?
The canonical SMILES for [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane is CCCCC(C)(C)C(C/C=C/I)O[Si](C)(C)C.
What is the InChIKey of [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane?
The InChIKey is XRXZWYJHWFSWGO-FMIVXFBMSA-N. The full InChI is InChI=1S/C14H29IOSi/c1-7-8-11-14(2,3)13(10-9-12-15)16-17(4,5)6/h9,12-13H,7-8,10-11H2,1-6H3/b12-9+.
What are the key properties of [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane?
[(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane has a molecular weight of 368.38 g/mol, XLogP of 5.76, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane is sourced from PubChem (CID 152749210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).