C14H29IOSi — CID 152749210
[(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane (PubChem CID 152749210) has the molecular formula C14H29IOSi and a molecular weight of 368.38 g/mol. Its IUPAC name is [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane.
| Compound Name | [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 152749210 |
| Molecular Formula | C14H29IOSi |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | [(E)-1-iodo-5,5-dimethylnon-1-en-4-yl]oxy-trimethylsilane |
| SMILES | CCCCC(C)(C)C(C/C=C/I)O[Si](C)(C)C |
| InChI | InChI=1S/C14H29IOSi/c1-7-8-11-14(2,3)13(10-9-12-15)16-17(4,5)6/h9,12-13H,7-8,10-11H2,1-6H3/b12-9+ |
| InChIKey | XRXZWYJHWFSWGO-FMIVXFBMSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|