About triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane
triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane (PubChem CID 154116270) has the molecular formula C17H35IOSi
and a molecular weight of 410.46 g/mol. Its IUPAC name is triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane |
| PubChem CID | 154116270 |
| Molecular Formula | C17H35IOSi |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane |
| SMILES | CCCCC(C)(O[Si](CC)(CC)CC)C(C)(C)/C=C/I |
| InChI | InChI=1S/C17H35IOSi/c1-8-12-13-17(7,16(5,6)14-15-18)19-20(9-2,10-3)11-4/h14-15H,8-13H2,1-7H3/b15-14+ |
| InChIKey | IGLPZCGHXBIQKL-CCEZHUSRSA-N |
| XLogP | 6.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane?
The IUPAC name of triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane (CID 154116270) is triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane.
What is the SMILES notation for triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane?
The canonical SMILES for triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane is CCCCC(C)(O[Si](CC)(CC)CC)C(C)(C)/C=C/I.
What is the InChIKey of triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane?
The InChIKey is IGLPZCGHXBIQKL-CCEZHUSRSA-N. The full InChI is InChI=1S/C17H35IOSi/c1-8-12-13-17(7,16(5,6)14-15-18)19-20(9-2,10-3)11-4/h14-15H,8-13H2,1-7H3/b15-14+.
What are the key properties of triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane?
triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane has a molecular weight of 410.46 g/mol, XLogP of 6.93, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane is sourced from PubChem (CID 154116270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).