C17H35IOSi — CID 154116270
triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane (PubChem CID 154116270) has the molecular formula C17H35IOSi and a molecular weight of 410.46 g/mol. Its IUPAC name is triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane.
| Compound Name | triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane |
|---|---|
| PubChem CID | 154116270 |
| Molecular Formula | C17H35IOSi |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | triethyl-[(E)-1-iodo-3,3,4-trimethyloct-1-en-4-yl]oxysilane |
| SMILES | CCCCC(C)(O[Si](CC)(CC)CC)C(C)(C)/C=C/I |
| InChI | InChI=1S/C17H35IOSi/c1-8-12-13-17(7,16(5,6)14-15-18)19-20(9-2,10-3)11-4/h14-15H,8-13H2,1-7H3/b15-14+ |
| InChIKey | IGLPZCGHXBIQKL-CCEZHUSRSA-N |
| XLogP | 6.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|