C15H31IOSi — CID 54220348
triethyl-[(4R)-1-iodo-4-methyloct-1-en-4-yl]oxysilane (PubChem CID 54220348) has the molecular formula C15H31IOSi and a molecular weight of 382.40 g/mol. Its IUPAC name is triethyl-[(4R)-1-iodo-4-methyloct-1-en-4-yl]oxysilane.
| Compound Name | triethyl-[(4R)-1-iodo-4-methyloct-1-en-4-yl]oxysilane |
|---|---|
| PubChem CID | 54220348 |
| Molecular Formula | C15H31IOSi |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | triethyl-[(4R)-1-iodo-4-methyloct-1-en-4-yl]oxysilane |
| SMILES | CCCC[C@](C)(CC=CI)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C15H31IOSi/c1-6-10-12-15(5,13-11-14-16)17-18(7-2,8-3)9-4/h11,14H,6-10,12-13H2,1-5H3/t15-/m1/s1 |
| InChIKey | QCDLHOIEFHDTOJ-OAHLLOKOSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|