C38H71ClO5Si3 — CID 18602053
methyl 8-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-5-chlorooct-6-ynoate (PubChem CID 18602053) has the molecular formula C38H71ClO5Si3 and a molecular weight of 727.69 g/mol. Its IUPAC name is methyl 8-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-5-chlorooct-6-ynoate.
| Compound Name | methyl 8-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-5-chlorooct-6-ynoate |
|---|---|
| PubChem CID | 18602053 |
| Molecular Formula | C38H71ClO5Si3 |
| Molecular Weight | 727.69 g/mol |
| Exact Mass | 726.43 |
| IUPAC Name | methyl 8-[(4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(E)-4-methyl-4-trimethylsilyloxyoct-1-enyl]-4-triethylsilyloxycyclopenten-1-yl]-5-chlorooct-6-ynoate |
| SMILES | CCCCC(C)(C/C=C/[C@H]1C(CC#CC(Cl)CCCC(=O)OC)=C(O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](CC)(CC)CC)O[Si](C)(C)C |
| InChI | InChI=1S/C38H71ClO5Si3/c1-15-19-28-38(8,44-45(10,11)12)29-22-26-33-32(25-20-23-31(39)24-21-27-36(40)41-9)34(42-46(13,14)37(5,6)7)30-35(33)43-47(16-2,17-3)18-4/h22,26,31,33,35H,15-19,21,24-25,27-30H2,1-14H3/b26-22+/t31?,33-,35-,38?/m0/s1 |
| InChIKey | LPEWPOLMHKTJNP-SGCCPQPLSA-N |
| XLogP | 11.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.69 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|