C23H49AlOSi — CID 134990873
[(E)-1-[bis(2-methylpropyl)alumanyl]-4-methyloct-1-en-4-yl]oxy-triethylsilane (PubChem CID 134990873) has the molecular formula C23H49AlOSi and a molecular weight of 396.71 g/mol. Its IUPAC name is [(E)-1-[bis(2-methylpropyl)alumanyl]-4-methyloct-1-en-4-yl]oxy-triethylsilane.
| Compound Name | [(E)-1-[bis(2-methylpropyl)alumanyl]-4-methyloct-1-en-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 134990873 |
| Molecular Formula | C23H49AlOSi |
| Molecular Weight | 396.71 g/mol |
| Exact Mass | 396.34 |
| IUPAC Name | [(E)-1-[bis(2-methylpropyl)alumanyl]-4-methyloct-1-en-4-yl]oxy-triethylsilane |
| SMILES | CCCCC(C)(C/C=C/[Al](CC(C)C)CC(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C15H31OSi.2C4H9.Al/c1-7-12-14-15(6,13-8-2)16-17(9-3,10-4)11-5;2*1-4(2)3;/h2,8H,7,9-14H2,1,3-6H3;2*4H,1H2,2-3H3; |
| InChIKey | VAEJPUDILLZCCU-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.71 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|