C13H27IOSi — CID 152749211
[(E)-1-iodo-5,5-dimethyloct-1-en-4-yl]oxy-trimethylsilane (PubChem CID 152749211) has the molecular formula C13H27IOSi and a molecular weight of 354.35 g/mol. Its IUPAC name is [(E)-1-iodo-5,5-dimethyloct-1-en-4-yl]oxy-trimethylsilane.
| Compound Name | [(E)-1-iodo-5,5-dimethyloct-1-en-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 152749211 |
| Molecular Formula | C13H27IOSi |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [(E)-1-iodo-5,5-dimethyloct-1-en-4-yl]oxy-trimethylsilane |
| SMILES | CCCC(C)(C)C(C/C=C/I)O[Si](C)(C)C |
| InChI | InChI=1S/C13H27IOSi/c1-7-10-13(2,3)12(9-8-11-14)15-16(4,5)6/h8,11-12H,7,9-10H2,1-6H3/b11-8+ |
| InChIKey | NOVFVCULWSBCQC-DHZHZOJOSA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|