C24H46O2Si2 — CID 57101826
[2,5-bis(2-methylpentan-2-yl)-4-trimethylsilyloxyphenoxy]-trimethylsilane (PubChem CID 57101826) has the molecular formula C24H46O2Si2 and a molecular weight of 422.80 g/mol. Its IUPAC name is [2,5-bis(2-methylpentan-2-yl)-4-trimethylsilyloxyphenoxy]-trimethylsilane.
| Compound Name | [2,5-bis(2-methylpentan-2-yl)-4-trimethylsilyloxyphenoxy]-trimethylsilane |
|---|---|
| PubChem CID | 57101826 |
| Molecular Formula | C24H46O2Si2 |
| Molecular Weight | 422.80 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | [2,5-bis(2-methylpentan-2-yl)-4-trimethylsilyloxyphenoxy]-trimethylsilane |
| SMILES | CCCC(C)(C)c1cc(O[Si](C)(C)C)c(C(C)(C)CCC)cc1O[Si](C)(C)C |
| InChI | InChI=1S/C24H46O2Si2/c1-13-15-23(3,4)19-17-22(26-28(10,11)12)20(24(5,6)16-14-2)18-21(19)25-27(7,8)9/h17-18H,13-16H2,1-12H3 |
| InChIKey | BEOHGPJBYUDTHK-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.80 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|