C15H27O4PSi — CID 19770472
[3-methyl-3-(5-methyl-2-trimethylsilyloxyphenyl)butyl]phosphonic acid (PubChem CID 19770472) has the molecular formula C15H27O4PSi and a molecular weight of 330.44 g/mol. Its IUPAC name is [3-methyl-3-(5-methyl-2-trimethylsilyloxyphenyl)butyl]phosphonic acid.
| Compound Name | [3-methyl-3-(5-methyl-2-trimethylsilyloxyphenyl)butyl]phosphonic acid |
|---|---|
| PubChem CID | 19770472 |
| Molecular Formula | C15H27O4PSi |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | [3-methyl-3-(5-methyl-2-trimethylsilyloxyphenyl)butyl]phosphonic acid |
| SMILES | Cc1ccc(O[Si](C)(C)C)c(C(C)(C)CCP(=O)(O)O)c1 |
| InChI | InChI=1S/C15H27O4PSi/c1-12-7-8-14(19-21(4,5)6)13(11-12)15(2,3)9-10-20(16,17)18/h7-8,11H,9-10H2,1-6H3,(H2,16,17,18) |
| InChIKey | ABLMWDFBIWTMCV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|