C11H18AlO4P — CID 174376372
CID 174376372 (PubChem CID 174376372) has the molecular formula C11H18AlO4P and a molecular weight of 272.22 g/mol.
| Compound Name | CID 174376372 |
|---|---|
| PubChem CID | 174376372 |
| Molecular Formula | C11H18AlO4P |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | — |
| SMILES | Cc1ccc([Al])c(C(C)(C)C)c1.O=P(O)(O)O |
| InChI | InChI=1S/C11H15.Al.H3O4P/c1-9-6-5-7-10(8-9)11(2,3)4;;1-5(2,3)4/h5-6,8H,1-4H3;;(H3,1,2,3,4) |
| InChIKey | KUDZSUOUSRSDEN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|