C14H23O4P — CID 88685317
[4-(2-hydroxy-5-methylphenyl)-2,4-dimethylpentan-2-yl]phosphonic acid (PubChem CID 88685317) has the molecular formula C14H23O4P and a molecular weight of 286.31 g/mol. Its IUPAC name is [4-(2-hydroxy-5-methylphenyl)-2,4-dimethylpentan-2-yl]phosphonic acid.
| Compound Name | [4-(2-hydroxy-5-methylphenyl)-2,4-dimethylpentan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 88685317 |
| Molecular Formula | C14H23O4P |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | [4-(2-hydroxy-5-methylphenyl)-2,4-dimethylpentan-2-yl]phosphonic acid |
| SMILES | Cc1ccc(O)c(C(C)(C)CC(C)(C)P(=O)(O)O)c1 |
| InChI | InChI=1S/C14H23O4P/c1-10-6-7-12(15)11(8-10)13(2,3)9-14(4,5)19(16,17)18/h6-8,15H,9H2,1-5H3,(H2,16,17,18) |
| InChIKey | QVVKTRVTUDQHMD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|