C23H33NO2 — CID 57201454
2-[2-(2-hydroxy-5-methylphenyl)-4-(2-methylbutan-2-ylamino)butan-2-yl]-4-methylphenol (PubChem CID 57201454) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is 2-[2-(2-hydroxy-5-methylphenyl)-4-(2-methylbutan-2-ylamino)butan-2-yl]-4-methylphenol.
| Compound Name | 2-[2-(2-hydroxy-5-methylphenyl)-4-(2-methylbutan-2-ylamino)butan-2-yl]-4-methylphenol |
|---|---|
| PubChem CID | 57201454 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 2-[2-(2-hydroxy-5-methylphenyl)-4-(2-methylbutan-2-ylamino)butan-2-yl]-4-methylphenol |
| SMILES | CCC(C)(C)NCCC(C)(c1cc(C)ccc1O)c1cc(C)ccc1O |
| InChI | InChI=1S/C23H33NO2/c1-7-22(4,5)24-13-12-23(6,18-14-16(2)8-10-20(18)25)19-15-17(3)9-11-21(19)26/h8-11,14-15,24-26H,7,12-13H2,1-6H3 |
| InChIKey | MNVYPKDIEBYVKN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |