About 2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine
2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine (PubChem CID 80605045) has the molecular formula C13H19F2N
and a molecular weight of 227.30 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine.
Molecular Properties
| Compound Name | 2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine |
| PubChem CID | 80605045 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine |
| SMILES | CCNC(C)(c1cc(C)ccc1C)C(F)F |
| InChI | InChI=1S/C13H19F2N/c1-5-16-13(4,12(14)15)11-8-9(2)6-7-10(11)3/h6-8,12,16H,5H2,1-4H3 |
| InChIKey | YIAOLHOPJVOEDV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine?
The IUPAC name of 2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine (CID 80605045) is 2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine.
What is the SMILES notation for 2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine?
The canonical SMILES for 2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine is CCNC(C)(c1cc(C)ccc1C)C(F)F.
What is the InChIKey of 2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine?
The InChIKey is YIAOLHOPJVOEDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F2N/c1-5-16-13(4,12(14)15)11-8-9(2)6-7-10(11)3/h6-8,12,16H,5H2,1-4H3.
What are the key properties of 2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine?
2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine has a molecular weight of 227.30 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylphenyl)-N-ethyl-1,1-difluoropropan-2-amine is sourced from PubChem (CID 80605045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).