C15H25NO — CID 62773602
1-(tert-butylamino)-2-(2,5-dimethylphenyl)propan-2-ol (PubChem CID 62773602) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-(tert-butylamino)-2-(2,5-dimethylphenyl)propan-2-ol.
| Compound Name | 1-(tert-butylamino)-2-(2,5-dimethylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 62773602 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 1-(tert-butylamino)-2-(2,5-dimethylphenyl)propan-2-ol |
| SMILES | Cc1ccc(C)c(C(C)(O)CNC(C)(C)C)c1 |
| InChI | InChI=1S/C15H25NO/c1-11-7-8-12(2)13(9-11)15(6,17)10-16-14(3,4)5/h7-9,16-17H,10H2,1-6H3 |
| InChIKey | SYKPTOAKUZDGKS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |