C22H32Cl2O2Zr — CID 21185304
bis(2-tert-butyl-4-methylphenol);dichlorozirconium (PubChem CID 21185304) has the molecular formula C22H32Cl2O2Zr and a molecular weight of 490.63 g/mol. Its IUPAC name is bis(2-tert-butyl-4-methylphenol);dichlorozirconium.
| Compound Name | bis(2-tert-butyl-4-methylphenol);dichlorozirconium |
|---|---|
| PubChem CID | 21185304 |
| Molecular Formula | C22H32Cl2O2Zr |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | bis(2-tert-butyl-4-methylphenol);dichlorozirconium |
| SMILES | Cc1ccc(O)c(C(C)(C)C)c1.Cc1ccc(O)c(C(C)(C)C)c1.Cl[Zr]Cl |
| InChI | InChI=1S/2C11H16O.2ClH.Zr/c2*1-8-5-6-10(12)9(7-8)11(2,3)4;;;/h2*5-7,12H,1-4H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | GWNYODUPAVKXJH-UHFFFAOYSA-L |
| XLogP | 7.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |