C16H21N3O4 — CID 175010264
[1-[4-[1-(aminomethyl)cyclopropyl]phenyl]-5-hydroxy-2-oxopiperidin-3-yl] carbamate (PubChem CID 175010264) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is [1-[4-[1-(aminomethyl)cyclopropyl]phenyl]-5-hydroxy-2-oxopiperidin-3-yl] carbamate.
| Compound Name | [1-[4-[1-(aminomethyl)cyclopropyl]phenyl]-5-hydroxy-2-oxopiperidin-3-yl] carbamate |
|---|---|
| PubChem CID | 175010264 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | [1-[4-[1-(aminomethyl)cyclopropyl]phenyl]-5-hydroxy-2-oxopiperidin-3-yl] carbamate |
| SMILES | NCC1(c2ccc(N3CC(O)CC(OC(N)=O)C3=O)cc2)CC1 |
| InChI | InChI=1S/C16H21N3O4/c17-9-16(5-6-16)10-1-3-11(4-2-10)19-8-12(20)7-13(14(19)21)23-15(18)22/h1-4,12-13,20H,5-9,17H2,(H2,18,22) |
| InChIKey | GXUZMXDAOHHGLN-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |