C27H26N6O2 — CID 175011032
(E)-N-[2-[2-(2-morpholin-4-ylanilino)quinazolin-8-yl]-4-pyridinyl]but-2-enamide (PubChem CID 175011032) has the molecular formula C27H26N6O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is (E)-N-[2-[2-(2-morpholin-4-ylanilino)quinazolin-8-yl]-4-pyridinyl]but-2-enamide.
| Compound Name | (E)-N-[2-[2-(2-morpholin-4-ylanilino)quinazolin-8-yl]-4-pyridinyl]but-2-enamide |
|---|---|
| PubChem CID | 175011032 |
| Molecular Formula | C27H26N6O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (E)-N-[2-[2-(2-morpholin-4-ylanilino)quinazolin-8-yl]-4-pyridinyl]but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1ccnc(-c2cccc3cnc(Nc4ccccc4N4CCOCC4)nc23)c1 |
| InChI | InChI=1S/C27H26N6O2/c1-2-6-25(34)30-20-11-12-28-23(17-20)21-8-5-7-19-18-29-27(32-26(19)21)31-22-9-3-4-10-24(22)33-13-15-35-16-14-33/h2-12,17-18H,13-16H2,1H3,(H,28,30,34)(H,29,31,32)/b6-2+ |
| InChIKey | FSNXNOAOEOIMQL-QHHAFSJGSA-N |
| XLogP | 4.79 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|