About iodoethane;tris(ethenyl)phosphane
iodoethane;tris(ethenyl)phosphane (PubChem CID 175012346) has the molecular formula C8H14IP
and a molecular weight of 268.08 g/mol. Its IUPAC name is iodoethane;tris(ethenyl)phosphane.
Molecular Properties
| Compound Name | iodoethane;tris(ethenyl)phosphane |
| PubChem CID | 175012346 |
| Molecular Formula | C8H14IP |
| Molecular Weight | 268.08 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | iodoethane;tris(ethenyl)phosphane |
| SMILES | C=CP(C=C)C=C.CCI |
| InChI | InChI=1S/C6H9P.C2H5I/c1-4-7(5-2)6-3;1-2-3/h4-6H,1-3H2;2H2,1H3 |
| InChIKey | FHKKAOBBADVALS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.08 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze iodoethane;tris(ethenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodoethane;tris(ethenyl)phosphane?
The IUPAC name of iodoethane;tris(ethenyl)phosphane (CID 175012346) is iodoethane;tris(ethenyl)phosphane.
What is the SMILES notation for iodoethane;tris(ethenyl)phosphane?
The canonical SMILES for iodoethane;tris(ethenyl)phosphane is C=CP(C=C)C=C.CCI.
What is the InChIKey of iodoethane;tris(ethenyl)phosphane?
The InChIKey is FHKKAOBBADVALS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9P.C2H5I/c1-4-7(5-2)6-3;1-2-3/h4-6H,1-3H2;2H2,1H3.
What are the key properties of iodoethane;tris(ethenyl)phosphane?
iodoethane;tris(ethenyl)phosphane has a molecular weight of 268.08 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for iodoethane;tris(ethenyl)phosphane is sourced from PubChem (CID 175012346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).