C27H25N3O5 — CID 175012680
5-[(2-amino-3-phenylpropanoyl)amino]-4-ethoxycarbonyl-1-phenylindole-3-carboxylic acid (PubChem CID 175012680) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is 5-[(2-amino-3-phenylpropanoyl)amino]-4-ethoxycarbonyl-1-phenylindole-3-carboxylic acid.
| Compound Name | 5-[(2-amino-3-phenylpropanoyl)amino]-4-ethoxycarbonyl-1-phenylindole-3-carboxylic acid |
|---|---|
| PubChem CID | 175012680 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 5-[(2-amino-3-phenylpropanoyl)amino]-4-ethoxycarbonyl-1-phenylindole-3-carboxylic acid |
| SMILES | CCOC(=O)c1c(NC(=O)C(N)Cc2ccccc2)ccc2c1c(C(=O)O)cn2-c1ccccc1 |
| InChI | InChI=1S/C27H25N3O5/c1-2-35-27(34)24-21(29-25(31)20(28)15-17-9-5-3-6-10-17)13-14-22-23(24)19(26(32)33)16-30(22)18-11-7-4-8-12-18/h3-14,16,20H,2,15,28H2,1H3,(H,29,31)(H,32,33) |
| InChIKey | HLUFULZPNZPGOC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 123.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |