C17H14N2O6 — CID 175013264
4-hydroxy-3-methyl-N-[(2,3,4-trihydroxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 175013264) has the molecular formula C17H14N2O6 and a molecular weight of 342.31 g/mol. Its IUPAC name is 4-hydroxy-3-methyl-N-[(2,3,4-trihydroxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | 4-hydroxy-3-methyl-N-[(2,3,4-trihydroxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 175013264 |
| Molecular Formula | C17H14N2O6 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-hydroxy-3-methyl-N-[(2,3,4-trihydroxyphenyl)methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NN=Cc2ccc(O)c(O)c2O)oc2cccc(O)c12 |
| InChI | InChI=1S/C17H14N2O6/c1-8-13-10(20)3-2-4-12(13)25-16(8)17(24)19-18-7-9-5-6-11(21)15(23)14(9)22/h2-7,20-23H,1H3,(H,19,24) |
| InChIKey | LDELKHXVFGCHDM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|