C29H24ClNO4S — CID 175014806
[4-[2-[5-chloro-3-(1-phenylethoxycarbonylamino)thiophen-2-yl]phenyl]phenyl] cyclopropanecarboxylate (PubChem CID 175014806) has the molecular formula C29H24ClNO4S and a molecular weight of 518.03 g/mol. Its IUPAC name is [4-[2-[5-chloro-3-(1-phenylethoxycarbonylamino)thiophen-2-yl]phenyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [4-[2-[5-chloro-3-(1-phenylethoxycarbonylamino)thiophen-2-yl]phenyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 175014806 |
| Molecular Formula | C29H24ClNO4S |
| Molecular Weight | 518.03 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | [4-[2-[5-chloro-3-(1-phenylethoxycarbonylamino)thiophen-2-yl]phenyl]phenyl] cyclopropanecarboxylate |
| SMILES | CC(OC(=O)Nc1cc(Cl)sc1-c1ccccc1-c1ccc(OC(=O)C2CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H24ClNO4S/c1-18(19-7-3-2-4-8-19)34-29(33)31-25-17-26(30)36-27(25)24-10-6-5-9-23(24)20-13-15-22(16-14-20)35-28(32)21-11-12-21/h2-10,13-18,21H,11-12H2,1H3,(H,31,33) |
| InChIKey | HEAMSXAYMWQRMN-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.03 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|