C29H23ClFNO4S — CID 175017219
[4-[2-[5-chloro-3-[1-(3-fluorophenyl)ethoxycarbonylamino]thiophen-2-yl]phenyl]phenyl] cyclopropanecarboxylate (PubChem CID 175017219) has the molecular formula C29H23ClFNO4S and a molecular weight of 536.02 g/mol. Its IUPAC name is [4-[2-[5-chloro-3-[1-(3-fluorophenyl)ethoxycarbonylamino]thiophen-2-yl]phenyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [4-[2-[5-chloro-3-[1-(3-fluorophenyl)ethoxycarbonylamino]thiophen-2-yl]phenyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 175017219 |
| Molecular Formula | C29H23ClFNO4S |
| Molecular Weight | 536.02 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | [4-[2-[5-chloro-3-[1-(3-fluorophenyl)ethoxycarbonylamino]thiophen-2-yl]phenyl]phenyl] cyclopropanecarboxylate |
| SMILES | CC(OC(=O)Nc1cc(Cl)sc1-c1ccccc1-c1ccc(OC(=O)C2CC2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C29H23ClFNO4S/c1-17(20-5-4-6-21(31)15-20)35-29(34)32-25-16-26(30)37-27(25)24-8-3-2-7-23(24)18-11-13-22(14-12-18)36-28(33)19-9-10-19/h2-8,11-17,19H,9-10H2,1H3,(H,32,34) |
| InChIKey | DGGBVLNMFKELBD-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.02 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|