C22H8Cl4F6N8O3P+ — CID 175018003
bis[[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]amino]oxy]-oxophosphanium (PubChem CID 175018003) has the molecular formula C22H8Cl4F6N8O3P+ and a molecular weight of 719.13 g/mol. Its IUPAC name is bis[[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]amino]oxy]-oxophosphanium.
| Compound Name | bis[[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]amino]oxy]-oxophosphanium |
|---|---|
| PubChem CID | 175018003 |
| Molecular Formula | C22H8Cl4F6N8O3P+ |
| Molecular Weight | 719.13 g/mol |
| Exact Mass | 716.91 |
| IUPAC Name | bis[[[3-cyano-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]pyrazol-5-yl]amino]oxy]-oxophosphanium |
| SMILES | N#Cc1cc(NO[P+](=O)ONc2cc(C#N)nn2-c2c(Cl)cc(C(F)(F)F)cc2Cl)n(-c2c(Cl)cc(C(F)(F)F)cc2Cl)n1 |
| InChI | InChI=1S/C22H8Cl4F6N8O3P/c23-13-1-9(21(27,28)29)2-14(24)19(13)39-17(5-11(7-33)35-39)37-42-44(41)43-38-18-6-12(8-34)36-40(18)20-15(25)3-10(4-16(20)26)22(30,31)32/h1-6,37-38H/q+1 |
| InChIKey | DPAYCZBAXJWUCM-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 142.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.13 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|