C29H26N3OP — CID 175018822
N'-diphenylphosphoryl-2-phenyl-1-quinolin-2-ylethane-1,2-diamine (PubChem CID 175018822) has the molecular formula C29H26N3OP and a molecular weight of 463.52 g/mol. Its IUPAC name is N'-diphenylphosphoryl-2-phenyl-1-quinolin-2-ylethane-1,2-diamine.
| Compound Name | N'-diphenylphosphoryl-2-phenyl-1-quinolin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 175018822 |
| Molecular Formula | C29H26N3OP |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N'-diphenylphosphoryl-2-phenyl-1-quinolin-2-ylethane-1,2-diamine |
| SMILES | NC(c1ccc2ccccc2n1)C(NP(=O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H26N3OP/c30-28(27-21-20-22-12-10-11-19-26(22)31-27)29(23-13-4-1-5-14-23)32-34(33,24-15-6-2-7-16-24)25-17-8-3-9-18-25/h1-21,28-29H,30H2,(H,32,33) |
| InChIKey | VNGUQHVZIWHYLT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|