C21H23ClN2O2S — CID 175018932
tert-butyl-[1-(8-chloro-4-oxo-2-phenyl-1H-quinolin-3-yl)ethylamino]-oxidosulfanium (PubChem CID 175018932) has the molecular formula C21H23ClN2O2S and a molecular weight of 402.95 g/mol. Its IUPAC name is tert-butyl-[1-(8-chloro-4-oxo-2-phenyl-1H-quinolin-3-yl)ethylamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-(8-chloro-4-oxo-2-phenyl-1H-quinolin-3-yl)ethylamino]-oxidosulfanium |
|---|---|
| PubChem CID | 175018932 |
| Molecular Formula | C21H23ClN2O2S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | tert-butyl-[1-(8-chloro-4-oxo-2-phenyl-1H-quinolin-3-yl)ethylamino]-oxidosulfanium |
| SMILES | CC(N[S+]([O-])C(C)(C)C)c1c(-c2ccccc2)[nH]c2c(Cl)cccc2c1=O |
| InChI | InChI=1S/C21H23ClN2O2S/c1-13(24-27(26)21(2,3)4)17-18(14-9-6-5-7-10-14)23-19-15(20(17)25)11-8-12-16(19)22/h5-13,24H,1-4H3,(H,23,25) |
| InChIKey | LKYMFSMPFFYKAK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|