C22H17ClN6O — CID 140909765
3-[1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-chloro-2-phenyl-1H-quinolin-4-one (PubChem CID 140909765) has the molecular formula C22H17ClN6O and a molecular weight of 416.87 g/mol. Its IUPAC name is 3-[1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-chloro-2-phenyl-1H-quinolin-4-one.
| Compound Name | 3-[1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-chloro-2-phenyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 140909765 |
| Molecular Formula | C22H17ClN6O |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 3-[1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-chloro-2-phenyl-1H-quinolin-4-one |
| SMILES | [C-]#[N+]c1c(N)ncnc1NC(C)c1c(-c2ccccc2)[nH]c2c(Cl)cccc2c1=O |
| InChI | InChI=1S/C22H17ClN6O/c1-12(28-22-19(25-2)21(24)26-11-27-22)16-17(13-7-4-3-5-8-13)29-18-14(20(16)30)9-6-10-15(18)23/h3-12H,1H3,(H,29,30)(H3,24,26,27,28) |
| InChIKey | FPCFMOQZNLOSHC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|