C21H15FN6O — CID 140909764
3-[[(6-amino-5-isocyanopyrimidin-4-yl)amino]methyl]-8-fluoro-2-phenyl-1H-quinolin-4-one (PubChem CID 140909764) has the molecular formula C21H15FN6O and a molecular weight of 386.39 g/mol. Its IUPAC name is 3-[[(6-amino-5-isocyanopyrimidin-4-yl)amino]methyl]-8-fluoro-2-phenyl-1H-quinolin-4-one.
| Compound Name | 3-[[(6-amino-5-isocyanopyrimidin-4-yl)amino]methyl]-8-fluoro-2-phenyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 140909764 |
| Molecular Formula | C21H15FN6O |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 3-[[(6-amino-5-isocyanopyrimidin-4-yl)amino]methyl]-8-fluoro-2-phenyl-1H-quinolin-4-one |
| SMILES | [C-]#[N+]c1c(N)ncnc1NCc1c(-c2ccccc2)[nH]c2c(F)cccc2c1=O |
| InChI | InChI=1S/C21H15FN6O/c1-24-18-20(23)26-11-27-21(18)25-10-14-16(12-6-3-2-4-7-12)28-17-13(19(14)29)8-5-9-15(17)22/h2-9,11H,10H2,(H,28,29)(H3,23,25,26,27) |
| InChIKey | GBYSJSRFDHJQTF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|