C17H24N2O6 — CID 175020384
2-methyloctanediamide;terephthalic acid (PubChem CID 175020384) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-methyloctanediamide;terephthalic acid.
| Compound Name | 2-methyloctanediamide;terephthalic acid |
|---|---|
| PubChem CID | 175020384 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-methyloctanediamide;terephthalic acid |
| SMILES | CC(CCCCCC(N)=O)C(N)=O.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C9H18N2O2.C8H6O4/c1-7(9(11)13)5-3-2-4-6-8(10)12;9-7(10)5-1-2-6(4-3-5)8(11)12/h7H,2-6H2,1H3,(H2,10,12)(H2,11,13);1-4H,(H,9,10)(H,11,12) |
| InChIKey | MMMHRPHLPOODDO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|