C8H9F3N2O3S — CID 175022163
2-hydrazinyl-4-methyl-3-(trifluoromethyl)benzenesulfonic acid (PubChem CID 175022163) has the molecular formula C8H9F3N2O3S and a molecular weight of 270.23 g/mol. Its IUPAC name is 2-hydrazinyl-4-methyl-3-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 2-hydrazinyl-4-methyl-3-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 175022163 |
| Molecular Formula | C8H9F3N2O3S |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-hydrazinyl-4-methyl-3-(trifluoromethyl)benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(NN)c1C(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O3S/c1-4-2-3-5(17(14,15)16)7(13-12)6(4)8(9,10)11/h2-3,13H,12H2,1H3,(H,14,15,16) |
| InChIKey | LHKOKWWOYVVREY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|