C9H6F4O3S — CID 126699461
4-ethenyl-3-fluoro-2-(trifluoromethyl)benzenesulfonic acid (PubChem CID 126699461) has the molecular formula C9H6F4O3S and a molecular weight of 270.20 g/mol. Its IUPAC name is 4-ethenyl-3-fluoro-2-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 4-ethenyl-3-fluoro-2-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 126699461 |
| Molecular Formula | C9H6F4O3S |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 4-ethenyl-3-fluoro-2-(trifluoromethyl)benzenesulfonic acid |
| SMILES | C=Cc1ccc(S(=O)(=O)O)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C9H6F4O3S/c1-2-5-3-4-6(17(14,15)16)7(8(5)10)9(11,12)13/h2-4H,1H2,(H,14,15,16) |
| InChIKey | IPFPTZGMGJWZNX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|