About 5-bromothiophene-2-carboxylic acid;tricyclohexylstannane
5-bromothiophene-2-carboxylic acid;tricyclohexylstannane (PubChem CID 175022790) has the molecular formula C23H37BrO2SSn
and a molecular weight of 576.23 g/mol. Its IUPAC name is 5-bromothiophene-2-carboxylic acid;tricyclohexylstannane.
Molecular Properties
| Compound Name | 5-bromothiophene-2-carboxylic acid;tricyclohexylstannane |
| PubChem CID | 175022790 |
| Molecular Formula | C23H37BrO2SSn |
| Molecular Weight | 576.23 g/mol |
| Exact Mass | 576.07 |
| IUPAC Name | 5-bromothiophene-2-carboxylic acid;tricyclohexylstannane |
| SMILES | C1CCC([SnH](C2CCCCC2)C2CCCCC2)CC1.O=C(O)c1ccc(Br)s1 |
| InChI | InChI=1S/3C6H11.C5H3BrO2S.Sn.H/c3*1-2-4-6-5-3-1;6-4-2-1-3(9-4)5(7)8;;/h3*1H,2-6H2;1-2H,(H,7,8);; |
| InChIKey | PGESCNARVFXBCA-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 576.23 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromothiophene-2-carboxylic acid;tricyclohexylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromothiophene-2-carboxylic acid;tricyclohexylstannane?
The IUPAC name of 5-bromothiophene-2-carboxylic acid;tricyclohexylstannane (CID 175022790) is 5-bromothiophene-2-carboxylic acid;tricyclohexylstannane.
What is the SMILES notation for 5-bromothiophene-2-carboxylic acid;tricyclohexylstannane?
The canonical SMILES for 5-bromothiophene-2-carboxylic acid;tricyclohexylstannane is C1CCC([SnH](C2CCCCC2)C2CCCCC2)CC1.O=C(O)c1ccc(Br)s1.
What is the InChIKey of 5-bromothiophene-2-carboxylic acid;tricyclohexylstannane?
The InChIKey is PGESCNARVFXBCA-UHFFFAOYSA-N. The full InChI is InChI=1S/3C6H11.C5H3BrO2S.Sn.H/c3*1-2-4-6-5-3-1;6-4-2-1-3(9-4)5(7)8;;/h3*1H,2-6H2;1-2H,(H,7,8);;.
What are the key properties of 5-bromothiophene-2-carboxylic acid;tricyclohexylstannane?
5-bromothiophene-2-carboxylic acid;tricyclohexylstannane has a molecular weight of 576.23 g/mol, XLogP of 8.43, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromothiophene-2-carboxylic acid;tricyclohexylstannane is sourced from PubChem (CID 175022790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).