C18H27NO3 — CID 175023939
trans-(1R,6S)-N-[1-(3,4-dihydroxyphenyl)ethyl]-2,2,6-trimethylcyclohexane-1-carboxamide (PubChem CID 175023939) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is trans-(1R,6S)-N-[1-(3,4-dihydroxyphenyl)ethyl]-2,2,6-trimethylcyclohexane-1-carboxamide.
| Compound Name | trans-(1R,6S)-N-[1-(3,4-dihydroxyphenyl)ethyl]-2,2,6-trimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 175023939 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | trans-(1R,6S)-N-[1-(3,4-dihydroxyphenyl)ethyl]-2,2,6-trimethylcyclohexane-1-carboxamide |
| SMILES | CC(NC(=O)[C@@H]1[C@@H](C)CCCC1(C)C)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H27NO3/c1-11-6-5-9-18(3,4)16(11)17(22)19-12(2)13-7-8-14(20)15(21)10-13/h7-8,10-12,16,20-21H,5-6,9H2,1-4H3,(H,19,22)/t11-,12?,16-/m0/s1 |
| InChIKey | XIJQDBLRRZGPOF-ASIDQLCPSA-N |
| XLogP | 3.74 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|