C8H5F3O3S — CID 175024265
2,4,4-trifluoro-1-(5-hydroxythiophen-2-yl)butane-1,3-dione (PubChem CID 175024265) has the molecular formula C8H5F3O3S and a molecular weight of 238.19 g/mol. Its IUPAC name is 2,4,4-trifluoro-1-(5-hydroxythiophen-2-yl)butane-1,3-dione.
| Compound Name | 2,4,4-trifluoro-1-(5-hydroxythiophen-2-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 175024265 |
| Molecular Formula | C8H5F3O3S |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | 2,4,4-trifluoro-1-(5-hydroxythiophen-2-yl)butane-1,3-dione |
| SMILES | O=C(c1ccc(O)s1)C(F)C(=O)C(F)F |
| InChI | InChI=1S/C8H5F3O3S/c9-5(7(14)8(10)11)6(13)3-1-2-4(12)15-3/h1-2,5,8,12H |
| InChIKey | XLXJZPDOUANKND-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|