C24H23F3N6O — CID 175029449
1-[4-(diethylamino)phenyl]-3-[4-[3-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]phenyl]urea (PubChem CID 175029449) has the molecular formula C24H23F3N6O and a molecular weight of 468.48 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-3-[4-[3-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]phenyl]urea.
| Compound Name | 1-[4-(diethylamino)phenyl]-3-[4-[3-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]phenyl]urea |
|---|---|
| PubChem CID | 175029449 |
| Molecular Formula | C24H23F3N6O |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-3-[4-[3-(trifluoromethyl)-2H-pyrazolo[3,4-b]pyridin-4-yl]phenyl]urea |
| SMILES | CCN(CC)c1ccc(NC(=O)Nc2ccc(-c3ccnc4n[nH]c(C(F)(F)F)c34)cc2)cc1 |
| InChI | InChI=1S/C24H23F3N6O/c1-3-33(4-2)18-11-9-17(10-12-18)30-23(34)29-16-7-5-15(6-8-16)19-13-14-28-22-20(19)21(31-32-22)24(25,26)27/h5-14H,3-4H2,1-2H3,(H,28,31,32)(H2,29,30,34) |
| InChIKey | TYVWOCXOMRFHIF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|