C15H17FO12S — CID 175036705
fluoro [2-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydrochromen-6-yl] sulfate (PubChem CID 175036705) has the molecular formula C15H17FO12S and a molecular weight of 440.35 g/mol. Its IUPAC name is fluoro [2-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydrochromen-6-yl] sulfate.
| Compound Name | fluoro [2-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydrochromen-6-yl] sulfate |
|---|---|
| PubChem CID | 175036705 |
| Molecular Formula | C15H17FO12S |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | fluoro [2-oxo-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydrochromen-6-yl] sulfate |
| SMILES | O=C1CCc2cc(OS(=O)(=O)OF)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2O1 |
| InChI | InChI=1S/C15H17FO12S/c16-28-29(22,23)27-9-3-6-1-2-11(18)24-7(6)4-8(9)25-15-14(21)13(20)12(19)10(5-17)26-15/h3-4,10,12-15,17,19-21H,1-2,5H2/t10-,12-,13+,14-,15-/m1/s1 |
| InChIKey | XJFCZZSRDOWQCE-TVKJYDDYSA-N |
| XLogP | -1.76 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|