C14H16O8 — CID 56681180
5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3H-1-benzofuran-2-one (PubChem CID 56681180) has the molecular formula C14H16O8 and a molecular weight of 312.27 g/mol. Its IUPAC name is 5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3H-1-benzofuran-2-one.
| Compound Name | 5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 56681180 |
| Molecular Formula | C14H16O8 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3H-1-benzofuran-2-one |
| SMILES | O=C1Cc2cc(OC3OC(CO)C(O)C(O)C3O)ccc2O1 |
| InChI | InChI=1S/C14H16O8/c15-5-9-11(17)12(18)13(19)14(22-9)20-7-1-2-8-6(3-7)4-10(16)21-8/h1-3,9,11-15,17-19H,4-5H2 |
| InChIKey | LLQCVAMTJUZCCK-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|