C11H15FN4O3 — CID 175037383
[(E)-2-[[4-(dimethylcarbamoyl)pyrazol-1-yl]methyl]-3-fluoroprop-2-enyl] carbamate (PubChem CID 175037383) has the molecular formula C11H15FN4O3 and a molecular weight of 270.26 g/mol. Its IUPAC name is [(E)-2-[[4-(dimethylcarbamoyl)pyrazol-1-yl]methyl]-3-fluoroprop-2-enyl] carbamate.
| Compound Name | [(E)-2-[[4-(dimethylcarbamoyl)pyrazol-1-yl]methyl]-3-fluoroprop-2-enyl] carbamate |
|---|---|
| PubChem CID | 175037383 |
| Molecular Formula | C11H15FN4O3 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [(E)-2-[[4-(dimethylcarbamoyl)pyrazol-1-yl]methyl]-3-fluoroprop-2-enyl] carbamate |
| SMILES | CN(C)C(=O)c1cnn(C/C(=C\F)COC(N)=O)c1 |
| InChI | InChI=1S/C11H15FN4O3/c1-15(2)10(17)9-4-14-16(6-9)5-8(3-12)7-19-11(13)18/h3-4,6H,5,7H2,1-2H3,(H2,13,18)/b8-3+ |
| InChIKey | GIUWTGDOWGDBBF-FPYGCLRLSA-N |
| XLogP | 0.53 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |