C13H19FN4O3 — CID 175038341
[2-[[3-(tert-butylcarbamoyl)pyrazol-1-yl]methyl]-3-fluoroprop-2-enyl] carbamate (PubChem CID 175038341) has the molecular formula C13H19FN4O3 and a molecular weight of 298.32 g/mol. Its IUPAC name is [2-[[3-(tert-butylcarbamoyl)pyrazol-1-yl]methyl]-3-fluoroprop-2-enyl] carbamate.
| Compound Name | [2-[[3-(tert-butylcarbamoyl)pyrazol-1-yl]methyl]-3-fluoroprop-2-enyl] carbamate |
|---|---|
| PubChem CID | 175038341 |
| Molecular Formula | C13H19FN4O3 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | [2-[[3-(tert-butylcarbamoyl)pyrazol-1-yl]methyl]-3-fluoroprop-2-enyl] carbamate |
| SMILES | CC(C)(C)NC(=O)c1ccn(CC(=CF)COC(N)=O)n1 |
| InChI | InChI=1S/C13H19FN4O3/c1-13(2,3)16-11(19)10-4-5-18(17-10)7-9(6-14)8-21-12(15)20/h4-6H,7-8H2,1-3H3,(H2,15,20)(H,16,19) |
| InChIKey | JHRRJRWHQUFYMF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |