C28H42N2O2 — CID 175043585
(E)-N-[4-(dimethylamino)phenyl]-5-(6-hydroxy-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methylpent-2-enamide (PubChem CID 175043585) has the molecular formula C28H42N2O2 and a molecular weight of 438.66 g/mol. Its IUPAC name is (E)-N-[4-(dimethylamino)phenyl]-5-(6-hydroxy-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methylpent-2-enamide.
| Compound Name | (E)-N-[4-(dimethylamino)phenyl]-5-(6-hydroxy-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methylpent-2-enamide |
|---|---|
| PubChem CID | 175043585 |
| Molecular Formula | C28H42N2O2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | (E)-N-[4-(dimethylamino)phenyl]-5-(6-hydroxy-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methylpent-2-enamide |
| SMILES | C=C1CCC2C(C(C)CC(O)C2(C)C)C1CC/C(C)=C/C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C28H42N2O2/c1-18(16-26(32)29-21-10-12-22(13-11-21)30(6)7)8-14-23-19(2)9-15-24-27(23)20(3)17-25(31)28(24,4)5/h10-13,16,20,23-25,27,31H,2,8-9,14-15,17H2,1,3-7H3,(H,29,32)/b18-16+ |
| InChIKey | NUAOFQCKOXDLGT-FBMGVBCBSA-N |
| XLogP | 6.04 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|