C25H42N2O2 — CID 175180096
(E)-5-(6-hydroxy-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methyl-1-(4-methylpiperazin-1-yl)pent-2-en-1-one (PubChem CID 175180096) has the molecular formula C25H42N2O2 and a molecular weight of 402.62 g/mol. Its IUPAC name is (E)-5-(6-hydroxy-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methyl-1-(4-methylpiperazin-1-yl)pent-2-en-1-one.
| Compound Name | (E)-5-(6-hydroxy-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methyl-1-(4-methylpiperazin-1-yl)pent-2-en-1-one |
|---|---|
| PubChem CID | 175180096 |
| Molecular Formula | C25H42N2O2 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.32 |
| IUPAC Name | (E)-5-(6-hydroxy-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl)-3-methyl-1-(4-methylpiperazin-1-yl)pent-2-en-1-one |
| SMILES | C=C1CCC2C(C(C)CC(O)C2(C)C)C1CC/C(C)=C/C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C25H42N2O2/c1-17(15-23(29)27-13-11-26(6)12-14-27)7-9-20-18(2)8-10-21-24(20)19(3)16-22(28)25(21,4)5/h15,19-22,24,28H,2,7-14,16H2,1,3-6H3/b17-15+ |
| InChIKey | PYFWKZQHUJCSNM-BMRADRMJSA-N |
| XLogP | 4.11 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|