C19H32O — CID 175247683
4-[(1S,8aS)-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylbutanal (PubChem CID 175247683) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 4-[(1S,8aS)-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylbutanal.
| Compound Name | 4-[(1S,8aS)-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylbutanal |
|---|---|
| PubChem CID | 175247683 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 4-[(1S,8aS)-5,5,8-trimethyl-2-methylidene-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylbutanal |
| SMILES | C=C1CCC2[C@H](C(C)CCC2(C)C)[C@@H]1CCC(C)C=O |
| InChI | InChI=1S/C19H32O/c1-13(12-20)6-8-16-14(2)7-9-17-18(16)15(3)10-11-19(17,4)5/h12-13,15-18H,2,6-11H2,1,3-5H3/t13?,15?,16-,17?,18-/m1/s1 |
| InChIKey | VXAYPHYWIUPVJU-XAMVCXPESA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|