C26H40O2 — CID 175775220
[(1R,4aS,5R)-5-[2-(4-tert-butylphenoxy)ethyl]-1,4-dimethyl-6-methylidene-2,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]methanol (PubChem CID 175775220) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is [(1R,4aS,5R)-5-[2-(4-tert-butylphenoxy)ethyl]-1,4-dimethyl-6-methylidene-2,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]methanol.
| Compound Name | [(1R,4aS,5R)-5-[2-(4-tert-butylphenoxy)ethyl]-1,4-dimethyl-6-methylidene-2,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 175775220 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | [(1R,4aS,5R)-5-[2-(4-tert-butylphenoxy)ethyl]-1,4-dimethyl-6-methylidene-2,3,4,4a,5,7,8,8a-octahydronaphthalen-1-yl]methanol |
| SMILES | C=C1CCC2[C@@H](C(C)CC[C@@]2(C)CO)[C@H]1CCOc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H40O2/c1-18-7-12-23-24(19(2)13-15-26(23,6)17-27)22(18)14-16-28-21-10-8-20(9-11-21)25(3,4)5/h8-11,19,22-24,27H,1,7,12-17H2,2-6H3/t19?,22-,23?,24-,26-/m0/s1 |
| InChIKey | AEACXOBDKKBZNS-BQSGJEBHSA-N |
| XLogP | 6.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|