C22H26O6 — CID 19746566
4,4-bis[4-(2-hydroxyethoxy)phenyl]-2-methylidenepentanoic acid (PubChem CID 19746566) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is 4,4-bis[4-(2-hydroxyethoxy)phenyl]-2-methylidenepentanoic acid.
| Compound Name | 4,4-bis[4-(2-hydroxyethoxy)phenyl]-2-methylidenepentanoic acid |
|---|---|
| PubChem CID | 19746566 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4,4-bis[4-(2-hydroxyethoxy)phenyl]-2-methylidenepentanoic acid |
| SMILES | C=C(CC(C)(c1ccc(OCCO)cc1)c1ccc(OCCO)cc1)C(=O)O |
| InChI | InChI=1S/C22H26O6/c1-16(21(25)26)15-22(2,17-3-7-19(8-4-17)27-13-11-23)18-5-9-20(10-6-18)28-14-12-24/h3-10,23-24H,1,11-15H2,2H3,(H,25,26) |
| InChIKey | KUXNYADQOYXNPR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|